C27H51N3O12 — CID 67180263
benzene-1,2,3-tricarboxylate;tris(bis(2-methoxyethyl)azanium) (PubChem CID 67180263) has the molecular formula C27H51N3O12 and a molecular weight of 609.71 g/mol. Its IUPAC name is benzene-1,2,3-tricarboxylate;tris(bis(2-methoxyethyl)azanium).
| Compound Name | benzene-1,2,3-tricarboxylate;tris(bis(2-methoxyethyl)azanium) |
|---|---|
| PubChem CID | 67180263 |
| Molecular Formula | C27H51N3O12 |
| Molecular Weight | 609.71 g/mol |
| Exact Mass | 609.35 |
| IUPAC Name | benzene-1,2,3-tricarboxylate;tris(bis(2-methoxyethyl)azanium) |
| SMILES | COCC[NH2+]CCOC.COCC[NH2+]CCOC.COCC[NH2+]CCOC.O=C([O-])c1cccc(C(=O)[O-])c1C(=O)[O-] |
| InChI | InChI=1S/C9H6O6.3C6H15NO2/c10-7(11)4-2-1-3-5(8(12)13)6(4)9(14)15;3*1-8-5-3-7-4-6-9-2/h1-3H,(H,10,11)(H,12,13)(H,14,15);3*7H,3-6H2,1-2H3 |
| InChIKey | JARYHIOFEOSXAH-UHFFFAOYSA-N |
| XLogP | -6.70 |
| TPSA | 225.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.71 |
| LogP ≤ 5 | -6.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|