C34H76N6O16 — CID 140529116
2-[2-[bis(carboxylatomethyl)amino]ethyl-(carboxylatomethyl)amino]acetate;tetrakis(bis(2-methoxyethyl)azanium) (PubChem CID 140529116) has the molecular formula C34H76N6O16 and a molecular weight of 825.01 g/mol. Its IUPAC name is 2-[2-[bis(carboxylatomethyl)amino]ethyl-(carboxylatomethyl)amino]acetate;tetrakis(bis(2-methoxyethyl)azanium).
| Compound Name | 2-[2-[bis(carboxylatomethyl)amino]ethyl-(carboxylatomethyl)amino]acetate;tetrakis(bis(2-methoxyethyl)azanium) |
|---|---|
| PubChem CID | 140529116 |
| Molecular Formula | C34H76N6O16 |
| Molecular Weight | 825.01 g/mol |
| Exact Mass | 824.53 |
| IUPAC Name | 2-[2-[bis(carboxylatomethyl)amino]ethyl-(carboxylatomethyl)amino]acetate;tetrakis(bis(2-methoxyethyl)azanium) |
| SMILES | COCC[NH2+]CCOC.COCC[NH2+]CCOC.COCC[NH2+]CCOC.COCC[NH2+]CCOC.O=C([O-])CN(CCN(CC(=O)[O-])CC(=O)[O-])CC(=O)[O-] |
| InChI | InChI=1S/C10H16N2O8.4C6H15NO2/c13-7(14)3-11(4-8(15)16)1-2-12(5-9(17)18)6-10(19)20;4*1-8-5-3-7-4-6-9-2/h1-6H2,(H,13,14)(H,15,16)(H,17,18)(H,19,20);4*7H,3-6H2,1-2H3 |
| InChIKey | XAUMMWBMZWBLNJ-UHFFFAOYSA-N |
| XLogP | -12.04 |
| TPSA | 307.28 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 35 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 825.01 |
| LogP ≤ 5 | -12.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 18 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|