C33H63N3O6 — CID 171478300
benzene-1,2,3-tricarboxylate;tris(tetraethylazanium) (PubChem CID 171478300) has the molecular formula C33H63N3O6 and a molecular weight of 597.88 g/mol. Its IUPAC name is benzene-1,2,3-tricarboxylate;tris(tetraethylazanium).
| Compound Name | benzene-1,2,3-tricarboxylate;tris(tetraethylazanium) |
|---|---|
| PubChem CID | 171478300 |
| Molecular Formula | C33H63N3O6 |
| Molecular Weight | 597.88 g/mol |
| Exact Mass | 597.47 |
| IUPAC Name | benzene-1,2,3-tricarboxylate;tris(tetraethylazanium) |
| SMILES | CC[N+](CC)(CC)CC.CC[N+](CC)(CC)CC.CC[N+](CC)(CC)CC.O=C([O-])c1cccc(C(=O)[O-])c1C(=O)[O-] |
| InChI | InChI=1S/C9H6O6.3C8H20N/c10-7(11)4-2-1-3-5(8(12)13)6(4)9(14)15;3*1-5-9(6-2,7-3)8-4/h1-3H,(H,10,11)(H,12,13)(H,14,15);3*5-8H2,1-4H3/q;3*+1/p-3 |
| InChIKey | POBUGCZWEFSEQT-UHFFFAOYSA-K |
| XLogP | 2.43 |
| TPSA | 120.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.88 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|