About 2-methoxybenzoate;hydrochloride
2-methoxybenzoate;hydrochloride (PubChem CID 18793456) has the molecular formula C8H8ClO3-
and a molecular weight of 187.60 g/mol. Its IUPAC name is 2-methoxybenzoate;hydrochloride.
Molecular Properties
| Compound Name | 2-methoxybenzoate;hydrochloride |
| PubChem CID | 18793456 |
| Molecular Formula | C8H8ClO3- |
| Molecular Weight | 187.60 g/mol |
| Exact Mass | 187.02 |
| IUPAC Name | 2-methoxybenzoate;hydrochloride |
| SMILES | COc1ccccc1C(=O)[O-].Cl |
| InChI | InChI=1S/C8H8O3.ClH/c1-11-7-5-3-2-4-6(7)8(9)10;/h2-5H,1H3,(H,9,10);1H/p-1 |
| InChIKey | RWFXDZIZBGXSNL-UHFFFAOYSA-M |
| XLogP | 0.48 |
| TPSA | 49.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.60 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-methoxybenzoate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methoxybenzoate;hydrochloride?
The IUPAC name of 2-methoxybenzoate;hydrochloride (CID 18793456) is 2-methoxybenzoate;hydrochloride.
What is the SMILES notation for 2-methoxybenzoate;hydrochloride?
The canonical SMILES for 2-methoxybenzoate;hydrochloride is COc1ccccc1C(=O)[O-].Cl.
What is the InChIKey of 2-methoxybenzoate;hydrochloride?
The InChIKey is RWFXDZIZBGXSNL-UHFFFAOYSA-M. The full InChI is InChI=1S/C8H8O3.ClH/c1-11-7-5-3-2-4-6(7)8(9)10;/h2-5H,1H3,(H,9,10);1H/p-1.
What are the key properties of 2-methoxybenzoate;hydrochloride?
2-methoxybenzoate;hydrochloride has a molecular weight of 187.60 g/mol, XLogP of 0.48, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methoxybenzoate;hydrochloride is sourced from PubChem (CID 18793456), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).