C6H16BF4NO2 — CID 87299857
bis(2-methoxyethyl)azanium tetrafluoroborate (PubChem CID 87299857) has the molecular formula C6H16BF4NO2 and a molecular weight of 221.00 g/mol. Its IUPAC name is bis(2-methoxyethyl)azanium tetrafluoroborate.
| Compound Name | bis(2-methoxyethyl)azanium tetrafluoroborate |
|---|---|
| PubChem CID | 87299857 |
| Molecular Formula | C6H16BF4NO2 |
| Molecular Weight | 221.00 g/mol |
| Exact Mass | 221.12 |
| IUPAC Name | bis(2-methoxyethyl)azanium tetrafluoroborate |
| SMILES | COCC[NH2+]CCOC.F[B-](F)(F)F |
| InChI | InChI=1S/C6H15NO2.BF4/c1-8-5-3-7-4-6-9-2;2-1(3,4)5/h7H,3-6H2,1-2H3;/q;-1/p+1 |
| InChIKey | RXUOWCSDQSINNP-UHFFFAOYSA-O |
| XLogP | 0.14 |
| TPSA | 35.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.00 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|