C24H44N2O9 — CID 143118982
bis(bis(2-methoxyethyl)azanium);(E)-but-2-enoate;2-hydroxy-2-phenylacetate (PubChem CID 143118982) has the molecular formula C24H44N2O9 and a molecular weight of 504.62 g/mol. Its IUPAC name is bis(bis(2-methoxyethyl)azanium);(E)-but-2-enoate;2-hydroxy-2-phenylacetate.
| Compound Name | bis(bis(2-methoxyethyl)azanium);(E)-but-2-enoate;2-hydroxy-2-phenylacetate |
|---|---|
| PubChem CID | 143118982 |
| Molecular Formula | C24H44N2O9 |
| Molecular Weight | 504.62 g/mol |
| Exact Mass | 504.30 |
| IUPAC Name | bis(bis(2-methoxyethyl)azanium);(E)-but-2-enoate;2-hydroxy-2-phenylacetate |
| SMILES | C/C=C/C(=O)[O-].COCC[NH2+]CCOC.COCC[NH2+]CCOC.O=C([O-])C(O)c1ccccc1 |
| InChI | InChI=1S/C8H8O3.2C6H15NO2.C4H6O2/c9-7(8(10)11)6-4-2-1-3-5-6;2*1-8-5-3-7-4-6-9-2;1-2-3-4(5)6/h1-5,7,9H,(H,10,11);2*7H,3-6H2,1-2H3;2-3H,1H3,(H,5,6)/b;;;3-2+ |
| InChIKey | GUPWKHRISCCHCQ-NFQZDYBZSA-N |
| XLogP | -3.53 |
| TPSA | 170.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.62 |
| LogP ≤ 5 | -3.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|