C21H25N3O5 — CID 135441075
[amino(azaniumylidene)methyl]-[2-[(2-methylphenyl)-phenylmethoxy]ethyl]azanium;(E)-but-2-enedioate (PubChem CID 135441075) has the molecular formula C21H25N3O5 and a molecular weight of 399.45 g/mol. Its IUPAC name is [amino(azaniumylidene)methyl]-[2-[(2-methylphenyl)-phenylmethoxy]ethyl]azanium;(E)-but-2-enedioate.
| Compound Name | [amino(azaniumylidene)methyl]-[2-[(2-methylphenyl)-phenylmethoxy]ethyl]azanium;(E)-but-2-enedioate |
|---|---|
| PubChem CID | 135441075 |
| Molecular Formula | C21H25N3O5 |
| Molecular Weight | 399.45 g/mol |
| Exact Mass | 399.18 |
| IUPAC Name | [amino(azaniumylidene)methyl]-[2-[(2-methylphenyl)-phenylmethoxy]ethyl]azanium;(E)-but-2-enedioate |
| SMILES | Cc1ccccc1C(OCC[NH2+]C(N)=[NH2+])c1ccccc1.O=C([O-])/C=C/C(=O)[O-] |
| InChI | InChI=1S/C17H21N3O.C4H4O4/c1-13-7-5-6-10-15(13)16(14-8-3-2-4-9-14)21-12-11-20-17(18)19;5-3(6)1-2-4(7)8/h2-10,16H,11-12H2,1H3,(H4,18,19,20);1-2H,(H,5,6)(H,7,8)/b;2-1+ |
| InChIKey | WSBKJUVCFYWWFV-WLHGVMLRSA-N |
| XLogP | -3.22 |
| TPSA | 157.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.45 |
| LogP ≤ 5 | -3.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|