C40H55NO3 — CID 123785860
2-[ethyl-[2-[(2-methylphenyl)-phenylmethoxy]ethyl]amino]ethyl icosa-5,8,11,14,17-pentaenoate (PubChem CID 123785860) has the molecular formula C40H55NO3 and a molecular weight of 597.88 g/mol. Its IUPAC name is 2-[ethyl-[2-[(2-methylphenyl)-phenylmethoxy]ethyl]amino]ethyl icosa-5,8,11,14,17-pentaenoate.
| Compound Name | 2-[ethyl-[2-[(2-methylphenyl)-phenylmethoxy]ethyl]amino]ethyl icosa-5,8,11,14,17-pentaenoate |
|---|---|
| PubChem CID | 123785860 |
| Molecular Formula | C40H55NO3 |
| Molecular Weight | 597.88 g/mol |
| Exact Mass | 597.42 |
| IUPAC Name | 2-[ethyl-[2-[(2-methylphenyl)-phenylmethoxy]ethyl]amino]ethyl icosa-5,8,11,14,17-pentaenoate |
| SMILES | CCC=CCC=CCC=CCC=CCC=CCCCC(=O)OCCN(CC)CCOC(c1ccccc1)c1ccccc1C |
| InChI | InChI=1S/C40H55NO3/c1-4-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-24-31-39(42)43-34-32-41(5-2)33-35-44-40(37-28-22-21-23-29-37)38-30-26-25-27-36(38)3/h6-7,9-10,12-13,15-16,18-19,21-23,25-30,40H,4-5,8,11,14,17,20,24,31-35H2,1-3H3 |
| InChIKey | MVSYKWNOJNPQDI-UHFFFAOYSA-N |
| XLogP | 9.89 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.88 |
| LogP ≤ 5 | 9.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|