C49H68ClNO4 — CID 145267681
2-[(5Z)-3-[(4-chlorobenzoyl)amino]-7-methyl-5-(2-methylphenyl)octa-1,5,7-trien-2-yl]oxyethyl (5Z,8Z,11Z,14Z,17Z)-icosa-5,8,11,14,17-pentaenoate;ethane (PubChem CID 145267681) has the molecular formula C49H68ClNO4 and a molecular weight of 770.54 g/mol. Its IUPAC name is 2-[(5Z)-3-[(4-chlorobenzoyl)amino]-7-methyl-5-(2-methylphenyl)octa-1,5,7-trien-2-yl]oxyethyl (5Z,8Z,11Z,14Z,17Z)-icosa-5,8,11,14,17-pentaenoate;ethane.
| Compound Name | 2-[(5Z)-3-[(4-chlorobenzoyl)amino]-7-methyl-5-(2-methylphenyl)octa-1,5,7-trien-2-yl]oxyethyl (5Z,8Z,11Z,14Z,17Z)-icosa-5,8,11,14,17-pentaenoate;ethane |
|---|---|
| PubChem CID | 145267681 |
| Molecular Formula | C49H68ClNO4 |
| Molecular Weight | 770.54 g/mol |
| Exact Mass | 769.48 |
| IUPAC Name | 2-[(5Z)-3-[(4-chlorobenzoyl)amino]-7-methyl-5-(2-methylphenyl)octa-1,5,7-trien-2-yl]oxyethyl (5Z,8Z,11Z,14Z,17Z)-icosa-5,8,11,14,17-pentaenoate;ethane |
| SMILES | C=C(C)/C=C(/CC(NC(=O)c1ccc(Cl)cc1)C(=C)OCCOC(=O)CCC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CC)c1ccccc1C.CC.CC |
| InChI | InChI=1S/C45H56ClNO4.2C2H6/c1-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-27-44(48)51-33-32-50-38(5)43(47-45(49)39-28-30-41(46)31-29-39)35-40(34-36(2)3)42-26-24-23-25-37(42)4;2*1-2/h7-8,10-11,13-14,16-17,19-20,23-26,28-31,34,43H,2,5-6,9,12,15,18,21-22,27,32-33,35H2,1,3-4H3,(H,47,49);2*1-2H3/b8-7-,11-10-,14-13-,17-16-,20-19-,40-34-;; |
| InChIKey | SAUDSVDOPWPPHX-VXHRDEQJSA-N |
| XLogP | 13.84 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 770.54 |
| LogP ≤ 5 | 13.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|