C32H28BLiO12 — CID 141072563
lithium;bis[(2-hydroxy-2-phenylacetyl)oxy]boranyl 2-hydroxy-2-phenylacetate;2-hydroxy-2-phenylacetate (PubChem CID 141072563) has the molecular formula C32H28BLiO12 and a molecular weight of 622.32 g/mol. Its IUPAC name is lithium;bis[(2-hydroxy-2-phenylacetyl)oxy]boranyl 2-hydroxy-2-phenylacetate;2-hydroxy-2-phenylacetate.
| Compound Name | lithium;bis[(2-hydroxy-2-phenylacetyl)oxy]boranyl 2-hydroxy-2-phenylacetate;2-hydroxy-2-phenylacetate |
|---|---|
| PubChem CID | 141072563 |
| Molecular Formula | C32H28BLiO12 |
| Molecular Weight | 622.32 g/mol |
| Exact Mass | 622.18 |
| IUPAC Name | lithium;bis[(2-hydroxy-2-phenylacetyl)oxy]boranyl 2-hydroxy-2-phenylacetate;2-hydroxy-2-phenylacetate |
| SMILES | O=C(OB(OC(=O)C(O)c1ccccc1)OC(=O)C(O)c1ccccc1)C(O)c1ccccc1.O=C([O-])C(O)c1ccccc1.[Li+] |
| InChI | InChI=1S/C24H21BO9.C8H8O3.Li/c26-19(16-10-4-1-5-11-16)22(29)32-25(33-23(30)20(27)17-12-6-2-7-13-17)34-24(31)21(28)18-14-8-3-9-15-18;9-7(8(10)11)6-4-2-1-3-5-6;/h1-15,19-21,26-28H;1-5,7,9H,(H,10,11);/q;;+1/p-1 |
| InChIKey | QKNXUQYIXUWVOX-UHFFFAOYSA-M |
| XLogP | -1.72 |
| TPSA | 199.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.32 |
| LogP ≤ 5 | -1.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|