C18H15O6-3 — CID 19973295
3,5,6-tris(prop-1-en-2-yl)benzene-1,2,4-tricarboxylate (PubChem CID 19973295) has the molecular formula C18H15O6-3 and a molecular weight of 327.31 g/mol. Its IUPAC name is 3,5,6-tris(prop-1-en-2-yl)benzene-1,2,4-tricarboxylate.
| Compound Name | 3,5,6-tris(prop-1-en-2-yl)benzene-1,2,4-tricarboxylate |
|---|---|
| PubChem CID | 19973295 |
| Molecular Formula | C18H15O6-3 |
| Molecular Weight | 327.31 g/mol |
| Exact Mass | 327.09 |
| IUPAC Name | 3,5,6-tris(prop-1-en-2-yl)benzene-1,2,4-tricarboxylate |
| SMILES | C=C(C)c1c(C(=C)C)c(C(=O)[O-])c(C(=O)[O-])c(C(=C)C)c1C(=O)[O-] |
| InChI | InChI=1S/C18H18O6/c1-7(2)10-11(8(3)4)14(17(21)22)15(18(23)24)12(9(5)6)13(10)16(19)20/h1,3,5H2,2,4,6H3,(H,19,20)(H,21,22)(H,23,24)/p-3 |
| InChIKey | DEVFJIKAOUCPHE-UHFFFAOYSA-K |
| XLogP | -0.12 |
| TPSA | 120.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.31 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |