About carbonochloridic acid;prop-1-en-2-olate
carbonochloridic acid;prop-1-en-2-olate (PubChem CID 172743448) has the molecular formula C4H6ClO3-
and a molecular weight of 137.54 g/mol. Its IUPAC name is carbonochloridic acid;prop-1-en-2-olate.
Molecular Properties
| Compound Name | carbonochloridic acid;prop-1-en-2-olate |
| PubChem CID | 172743448 |
| Molecular Formula | C4H6ClO3- |
| Molecular Weight | 137.54 g/mol |
| Exact Mass | 137.00 |
| IUPAC Name | carbonochloridic acid;prop-1-en-2-olate |
| SMILES | C=C(C)[O-].O=C(O)Cl |
| InChI | InChI=1S/C3H6O.CHClO2/c1-3(2)4;2-1(3)4/h4H,1H2,2H3;(H,3,4)/p-1 |
| InChIKey | MDSFXMXCMIIOQX-UHFFFAOYSA-M |
| XLogP | 0.78 |
| TPSA | 60.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 137.54 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze carbonochloridic acid;prop-1-en-2-olate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbonochloridic acid;prop-1-en-2-olate?
The IUPAC name of carbonochloridic acid;prop-1-en-2-olate (CID 172743448) is carbonochloridic acid;prop-1-en-2-olate.
What is the SMILES notation for carbonochloridic acid;prop-1-en-2-olate?
The canonical SMILES for carbonochloridic acid;prop-1-en-2-olate is C=C(C)[O-].O=C(O)Cl.
What is the InChIKey of carbonochloridic acid;prop-1-en-2-olate?
The InChIKey is MDSFXMXCMIIOQX-UHFFFAOYSA-M. The full InChI is InChI=1S/C3H6O.CHClO2/c1-3(2)4;2-1(3)4/h4H,1H2,2H3;(H,3,4)/p-1.
What are the key properties of carbonochloridic acid;prop-1-en-2-olate?
carbonochloridic acid;prop-1-en-2-olate has a molecular weight of 137.54 g/mol, XLogP of 0.78, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for carbonochloridic acid;prop-1-en-2-olate is sourced from PubChem (CID 172743448), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).