About potassium;prop-1-en-2-olate;hydrofluoride
potassium;prop-1-en-2-olate;hydrofluoride (PubChem CID 154632786) has the molecular formula C3H6FKO
and a molecular weight of 116.18 g/mol. Its IUPAC name is potassium;prop-1-en-2-olate;hydrofluoride.
Molecular Properties
| Compound Name | potassium;prop-1-en-2-olate;hydrofluoride |
| PubChem CID | 154632786 |
| Molecular Formula | C3H6FKO |
| Molecular Weight | 116.18 g/mol |
| Exact Mass | 116.00 |
| IUPAC Name | potassium;prop-1-en-2-olate;hydrofluoride |
| SMILES | C=C(C)[O-].F.[K+] |
| InChI | InChI=1S/C3H6O.FH.K/c1-3(2)4;;/h4H,1H2,2H3;1H;/q;;+1/p-1 |
| InChIKey | BGPZVUJCKQFVPI-UHFFFAOYSA-M |
| XLogP | -2.96 |
| TPSA | 23.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 116.18 |
| LogP ≤ 5 | -2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze potassium;prop-1-en-2-olate;hydrofluoride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium;prop-1-en-2-olate;hydrofluoride?
The IUPAC name of potassium;prop-1-en-2-olate;hydrofluoride (CID 154632786) is potassium;prop-1-en-2-olate;hydrofluoride.
What is the SMILES notation for potassium;prop-1-en-2-olate;hydrofluoride?
The canonical SMILES for potassium;prop-1-en-2-olate;hydrofluoride is C=C(C)[O-].F.[K+].
What is the InChIKey of potassium;prop-1-en-2-olate;hydrofluoride?
The InChIKey is BGPZVUJCKQFVPI-UHFFFAOYSA-M. The full InChI is InChI=1S/C3H6O.FH.K/c1-3(2)4;;/h4H,1H2,2H3;1H;/q;;+1/p-1.
What are the key properties of potassium;prop-1-en-2-olate;hydrofluoride?
potassium;prop-1-en-2-olate;hydrofluoride has a molecular weight of 116.18 g/mol, XLogP of -2.96, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for potassium;prop-1-en-2-olate;hydrofluoride is sourced from PubChem (CID 154632786), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).