C28H47O4- — CID 59271568
(E)-6-hydroxy-2,6,10-trimethyl-13-(2,7,8-trimethyl-3,4,4a,7,8,8a-hexahydrochromen-2-yl)tridec-9-enoate (PubChem CID 59271568) has the molecular formula C28H47O4- and a molecular weight of 447.68 g/mol. Its IUPAC name is (E)-6-hydroxy-2,6,10-trimethyl-13-(2,7,8-trimethyl-3,4,4a,7,8,8a-hexahydrochromen-2-yl)tridec-9-enoate.
| Compound Name | (E)-6-hydroxy-2,6,10-trimethyl-13-(2,7,8-trimethyl-3,4,4a,7,8,8a-hexahydrochromen-2-yl)tridec-9-enoate |
|---|---|
| PubChem CID | 59271568 |
| Molecular Formula | C28H47O4- |
| Molecular Weight | 447.68 g/mol |
| Exact Mass | 447.35 |
| IUPAC Name | (E)-6-hydroxy-2,6,10-trimethyl-13-(2,7,8-trimethyl-3,4,4a,7,8,8a-hexahydrochromen-2-yl)tridec-9-enoate |
| SMILES | C/C(=C\CCC(C)(O)CCCC(C)C(=O)[O-])CCCC1(C)CCC2C=CC(C)C(C)C2O1 |
| InChI | InChI=1S/C28H48O4/c1-20(10-7-16-27(5,31)17-9-12-22(3)26(29)30)11-8-18-28(6)19-15-24-14-13-21(2)23(4)25(24)32-28/h10,13-14,21-25,31H,7-9,11-12,15-19H2,1-6H3,(H,29,30)/p-1/b20-10+ |
| InChIKey | QVIPJHFHDZOPGE-KEBDBYFISA-M |
| XLogP | 5.59 |
| TPSA | 69.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.68 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|