C28H47O2- — CID 143728359
(7E)-3,7-dimethyl-14-(2,7,8-trimethyl-3,4,6,7,8,8a-hexahydrochromen-2-yl)tetradeca-1,7-dien-2-olate (PubChem CID 143728359) has the molecular formula C28H47O2- and a molecular weight of 415.68 g/mol. Its IUPAC name is (7E)-3,7-dimethyl-14-(2,7,8-trimethyl-3,4,6,7,8,8a-hexahydrochromen-2-yl)tetradeca-1,7-dien-2-olate.
| Compound Name | (7E)-3,7-dimethyl-14-(2,7,8-trimethyl-3,4,6,7,8,8a-hexahydrochromen-2-yl)tetradeca-1,7-dien-2-olate |
|---|---|
| PubChem CID | 143728359 |
| Molecular Formula | C28H47O2- |
| Molecular Weight | 415.68 g/mol |
| Exact Mass | 415.36 |
| IUPAC Name | (7E)-3,7-dimethyl-14-(2,7,8-trimethyl-3,4,6,7,8,8a-hexahydrochromen-2-yl)tetradeca-1,7-dien-2-olate |
| SMILES | C=C([O-])C(C)CCC/C(C)=C/CCCCCCC1(C)CCC2=CCC(C)C(C)C2O1 |
| InChI | InChI=1S/C28H48O2/c1-21(14-12-15-23(3)25(5)29)13-10-8-7-9-11-19-28(6)20-18-26-17-16-22(2)24(4)27(26)30-28/h13,17,22-24,27,29H,5,7-12,14-16,18-20H2,1-4,6H3/p-1/b21-13+ |
| InChIKey | DNFQMNSWZAAXGE-FYJGNVAPSA-M |
| XLogP | 7.49 |
| TPSA | 32.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.68 |
| LogP ≤ 5 | 7.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|