C28H48O3 — CID 59824181
(5E)-14-(2-ethyl-5,6-dimethylcyclohex-3-en-1-yl)oxy-2,6,10-trimethylpentadeca-5,14-dienoic acid (PubChem CID 59824181) has the molecular formula C28H48O3 and a molecular weight of 432.69 g/mol. Its IUPAC name is (5E)-14-(2-ethyl-5,6-dimethylcyclohex-3-en-1-yl)oxy-2,6,10-trimethylpentadeca-5,14-dienoic acid.
| Compound Name | (5E)-14-(2-ethyl-5,6-dimethylcyclohex-3-en-1-yl)oxy-2,6,10-trimethylpentadeca-5,14-dienoic acid |
|---|---|
| PubChem CID | 59824181 |
| Molecular Formula | C28H48O3 |
| Molecular Weight | 432.69 g/mol |
| Exact Mass | 432.36 |
| IUPAC Name | (5E)-14-(2-ethyl-5,6-dimethylcyclohex-3-en-1-yl)oxy-2,6,10-trimethylpentadeca-5,14-dienoic acid |
| SMILES | C=C(CCCC(C)CCC/C(C)=C/CCC(C)C(=O)O)OC1C(CC)C=CC(C)C1C |
| InChI | InChI=1S/C28H48O3/c1-8-26-19-18-22(4)25(7)27(26)31-24(6)17-11-15-21(3)13-9-12-20(2)14-10-16-23(5)28(29)30/h14,18-19,21-23,25-27H,6,8-13,15-17H2,1-5,7H3,(H,29,30)/b20-14+ |
| InChIKey | QFFATKSRVXQKDS-XSFVSMFZSA-N |
| XLogP | 8.18 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.69 |
| LogP ≤ 5 | 8.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|