C28H48O4 — CID 72571506
14-(2-ethyl-5,6-dimethylcyclohexa-1,3-dien-1-yl)oxy-15-hydroxy-2,6,10-trimethylpentadec-6-enoic acid (PubChem CID 72571506) has the molecular formula C28H48O4 and a molecular weight of 448.69 g/mol. Its IUPAC name is 14-(2-ethyl-5,6-dimethylcyclohexa-1,3-dien-1-yl)oxy-15-hydroxy-2,6,10-trimethylpentadec-6-enoic acid.
| Compound Name | 14-(2-ethyl-5,6-dimethylcyclohexa-1,3-dien-1-yl)oxy-15-hydroxy-2,6,10-trimethylpentadec-6-enoic acid |
|---|---|
| PubChem CID | 72571506 |
| Molecular Formula | C28H48O4 |
| Molecular Weight | 448.69 g/mol |
| Exact Mass | 448.36 |
| IUPAC Name | 14-(2-ethyl-5,6-dimethylcyclohexa-1,3-dien-1-yl)oxy-15-hydroxy-2,6,10-trimethylpentadec-6-enoic acid |
| SMILES | CCC1=C(OC(CO)CCCC(C)CCC=C(C)CCCC(C)C(=O)O)C(C)C(C)C=C1 |
| InChI | InChI=1S/C28H48O4/c1-7-25-18-17-22(4)24(6)27(25)32-26(19-29)16-10-14-21(3)12-8-11-20(2)13-9-15-23(5)28(30)31/h11,17-18,21-24,26,29H,7-10,12-16,19H2,1-6H3,(H,30,31) |
| InChIKey | MGCQAQVSVPHMMF-UHFFFAOYSA-N |
| XLogP | 7.29 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.69 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|