C28H49O4- — CID 59824213
(E)-14-(2-ethyl-5,6-dimethylcyclohex-3-en-1-yl)oxy-15-hydroxy-2,6,10-trimethylpentadec-5-enoate (PubChem CID 59824213) has the molecular formula C28H49O4- and a molecular weight of 449.70 g/mol. Its IUPAC name is (E)-14-(2-ethyl-5,6-dimethylcyclohex-3-en-1-yl)oxy-15-hydroxy-2,6,10-trimethylpentadec-5-enoate.
| Compound Name | (E)-14-(2-ethyl-5,6-dimethylcyclohex-3-en-1-yl)oxy-15-hydroxy-2,6,10-trimethylpentadec-5-enoate |
|---|---|
| PubChem CID | 59824213 |
| Molecular Formula | C28H49O4- |
| Molecular Weight | 449.70 g/mol |
| Exact Mass | 449.36 |
| IUPAC Name | (E)-14-(2-ethyl-5,6-dimethylcyclohex-3-en-1-yl)oxy-15-hydroxy-2,6,10-trimethylpentadec-5-enoate |
| SMILES | CCC1C=CC(C)C(C)C1OC(CO)CCCC(C)CCC/C(C)=C/CCC(C)C(=O)[O-] |
| InChI | InChI=1S/C28H50O4/c1-7-25-18-17-22(4)24(6)27(25)32-26(19-29)16-10-14-21(3)12-8-11-20(2)13-9-15-23(5)28(30)31/h13,17-18,21-27,29H,7-12,14-16,19H2,1-6H3,(H,30,31)/p-1/b20-13+ |
| InChIKey | LRHBLBXTTHJCHO-DEDYPNTBSA-M |
| XLogP | 5.69 |
| TPSA | 69.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.70 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|