C29H50O2 — CID 89374938
(6E)-15-(2-ethyl-5,6-dimethylcyclohex-3-en-1-yl)oxy-3,7,11-trimethylhexadeca-1,6,15-trien-2-ol (PubChem CID 89374938) has the molecular formula C29H50O2 and a molecular weight of 430.72 g/mol. Its IUPAC name is (6E)-15-(2-ethyl-5,6-dimethylcyclohex-3-en-1-yl)oxy-3,7,11-trimethylhexadeca-1,6,15-trien-2-ol.
| Compound Name | (6E)-15-(2-ethyl-5,6-dimethylcyclohex-3-en-1-yl)oxy-3,7,11-trimethylhexadeca-1,6,15-trien-2-ol |
|---|---|
| PubChem CID | 89374938 |
| Molecular Formula | C29H50O2 |
| Molecular Weight | 430.72 g/mol |
| Exact Mass | 430.38 |
| IUPAC Name | (6E)-15-(2-ethyl-5,6-dimethylcyclohex-3-en-1-yl)oxy-3,7,11-trimethylhexadeca-1,6,15-trien-2-ol |
| SMILES | C=C(CCCC(C)CCC/C(C)=C/CCC(C)C(=C)O)OC1C(CC)C=CC(C)C1C |
| InChI | InChI=1S/C29H50O2/c1-9-28-20-19-23(4)26(7)29(28)31-25(6)18-12-16-22(3)14-10-13-21(2)15-11-17-24(5)27(8)30/h15,19-20,22-24,26,28-30H,6,8-14,16-18H2,1-5,7H3/b21-15+ |
| InChIKey | COHQOXLQOIOLRM-RCCKNPSSSA-N |
| XLogP | 9.16 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.72 |
| LogP ≤ 5 | 9.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|