C12H20O — CID 89256398
(6E)-3,7-dimethyldeca-1,6,9-trien-2-ol (PubChem CID 89256398) has the molecular formula C12H20O and a molecular weight of 180.29 g/mol. Its IUPAC name is (6E)-3,7-dimethyldeca-1,6,9-trien-2-ol.
| Compound Name | (6E)-3,7-dimethyldeca-1,6,9-trien-2-ol |
|---|---|
| PubChem CID | 89256398 |
| Molecular Formula | C12H20O |
| Molecular Weight | 180.29 g/mol |
| Exact Mass | 180.15 |
| IUPAC Name | (6E)-3,7-dimethyldeca-1,6,9-trien-2-ol |
| SMILES | C=CC/C(C)=C/CCC(C)C(=C)O |
| InChI | InChI=1S/C12H20O/c1-5-7-10(2)8-6-9-11(3)12(4)13/h5,8,11,13H,1,4,6-7,9H2,2-3H3/b10-8+ |
| InChIKey | LKIUDSHJQZTYOW-CSKARUKUSA-N |
| XLogP | 4.00 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.29 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|