C7H11I — CID 89280235
(4Z)-6-iodo-4-methylhexa-1,4-diene (PubChem CID 89280235) has the molecular formula C7H11I and a molecular weight of 222.07 g/mol. Its IUPAC name is (4Z)-6-iodo-4-methylhexa-1,4-diene.
| Compound Name | (4Z)-6-iodo-4-methylhexa-1,4-diene |
|---|---|
| PubChem CID | 89280235 |
| Molecular Formula | C7H11I |
| Molecular Weight | 222.07 g/mol |
| Exact Mass | 221.99 |
| IUPAC Name | (4Z)-6-iodo-4-methylhexa-1,4-diene |
| SMILES | C=CC/C(C)=C\CI |
| InChI | InChI=1S/C7H11I/c1-3-4-7(2)5-6-8/h3,5H,1,4,6H2,2H3/b7-5- |
| InChIKey | CFMBPNAWZYMSNU-ALCCZGGFSA-N |
| XLogP | 2.94 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.07 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|