C7H10O — CID 88529058
(2E)-3-methylhexa-2,5-dienal (PubChem CID 88529058) has the molecular formula C7H10O and a molecular weight of 110.16 g/mol. Its IUPAC name is (2E)-3-methylhexa-2,5-dienal.
| Compound Name | (2E)-3-methylhexa-2,5-dienal |
|---|---|
| PubChem CID | 88529058 |
| Molecular Formula | C7H10O |
| Molecular Weight | 110.16 g/mol |
| Exact Mass | 110.07 |
| IUPAC Name | (2E)-3-methylhexa-2,5-dienal |
| SMILES | C=CC/C(C)=C/C=O |
| InChI | InChI=1S/C7H10O/c1-3-4-7(2)5-6-8/h3,5-6H,1,4H2,2H3/b7-5+ |
| InChIKey | MVMFUOWKPSCCIT-FNORWQNLSA-N |
| XLogP | 1.71 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 110.16 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|