C8H15N — CID 144887209
(1Z)-N-ethyl-2-methylpenta-1,4-dien-1-amine (PubChem CID 144887209) has the molecular formula C8H15N and a molecular weight of 125.21 g/mol. Its IUPAC name is (1Z)-N-ethyl-2-methylpenta-1,4-dien-1-amine.
| Compound Name | (1Z)-N-ethyl-2-methylpenta-1,4-dien-1-amine |
|---|---|
| PubChem CID | 144887209 |
| Molecular Formula | C8H15N |
| Molecular Weight | 125.21 g/mol |
| Exact Mass | 125.12 |
| IUPAC Name | (1Z)-N-ethyl-2-methylpenta-1,4-dien-1-amine |
| SMILES | C=CC/C(C)=C\NCC |
| InChI | InChI=1S/C8H15N/c1-4-6-8(3)7-9-5-2/h4,7,9H,1,5-6H2,2-3H3/b8-7- |
| InChIKey | NVYXCBATFWFDMZ-FPLPWBNLSA-N |
| XLogP | 2.08 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 125.21 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|