C7H16N2 — CID 163865379
(Z)-N-ethyl-N',2-dimethylprop-1-ene-1,3-diamine (PubChem CID 163865379) has the molecular formula C7H16N2 and a molecular weight of 128.22 g/mol. Its IUPAC name is (Z)-N-ethyl-N',2-dimethylprop-1-ene-1,3-diamine.
| Compound Name | (Z)-N-ethyl-N',2-dimethylprop-1-ene-1,3-diamine |
|---|---|
| PubChem CID | 163865379 |
| Molecular Formula | C7H16N2 |
| Molecular Weight | 128.22 g/mol |
| Exact Mass | 128.13 |
| IUPAC Name | (Z)-N-ethyl-N',2-dimethylprop-1-ene-1,3-diamine |
| SMILES | CCN/C=C(/C)CNC |
| InChI | InChI=1S/C7H16N2/c1-4-9-6-7(2)5-8-3/h6,8-9H,4-5H2,1-3H3/b7-6- |
| InChIKey | PGEFNOALTCYLKO-SREVYHEPSA-N |
| XLogP | 0.72 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 128.22 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |