C4H8Cl3N — CID 173449722
2,2-dichloro-N-ethylethenamine;hydrochloride (PubChem CID 173449722) has the molecular formula C4H8Cl3N and a molecular weight of 176.47 g/mol. Its IUPAC name is 2,2-dichloro-N-ethylethenamine;hydrochloride.
| Compound Name | 2,2-dichloro-N-ethylethenamine;hydrochloride |
|---|---|
| PubChem CID | 173449722 |
| Molecular Formula | C4H8Cl3N |
| Molecular Weight | 176.47 g/mol |
| Exact Mass | 174.97 |
| IUPAC Name | 2,2-dichloro-N-ethylethenamine;hydrochloride |
| SMILES | CCNC=C(Cl)Cl.Cl |
| InChI | InChI=1S/C4H7Cl2N.ClH/c1-2-7-3-4(5)6;/h3,7H,2H2,1H3;1H |
| InChIKey | ROEXIDIFQFAWGM-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.47 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |