C12H23N — CID 145174387
(1E,3E)-N-ethyl-2,3,4-trimethylhepta-1,3-dien-1-amine (PubChem CID 145174387) has the molecular formula C12H23N and a molecular weight of 181.32 g/mol. Its IUPAC name is (1E,3E)-N-ethyl-2,3,4-trimethylhepta-1,3-dien-1-amine.
| Compound Name | (1E,3E)-N-ethyl-2,3,4-trimethylhepta-1,3-dien-1-amine |
|---|---|
| PubChem CID | 145174387 |
| Molecular Formula | C12H23N |
| Molecular Weight | 181.32 g/mol |
| Exact Mass | 181.18 |
| IUPAC Name | (1E,3E)-N-ethyl-2,3,4-trimethylhepta-1,3-dien-1-amine |
| SMILES | CCC/C(C)=C(C)/C(C)=C/NCC |
| InChI | InChI=1S/C12H23N/c1-6-8-10(3)12(5)11(4)9-13-7-2/h9,13H,6-8H2,1-5H3/b11-9+,12-10+ |
| InChIKey | CNNMQSAZIMMZJS-WGDLNXRISA-N |
| XLogP | 3.64 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.32 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|