C11H24N2 — CID 166834532
(Z)-N'-ethyl-2-methyl-N-pentylprop-1-ene-1,3-diamine (PubChem CID 166834532) has the molecular formula C11H24N2 and a molecular weight of 184.33 g/mol. Its IUPAC name is (Z)-N'-ethyl-2-methyl-N-pentylprop-1-ene-1,3-diamine.
| Compound Name | (Z)-N'-ethyl-2-methyl-N-pentylprop-1-ene-1,3-diamine |
|---|---|
| PubChem CID | 166834532 |
| Molecular Formula | C11H24N2 |
| Molecular Weight | 184.33 g/mol |
| Exact Mass | 184.19 |
| IUPAC Name | (Z)-N'-ethyl-2-methyl-N-pentylprop-1-ene-1,3-diamine |
| SMILES | CCCCCN/C=C(/C)CNCC |
| InChI | InChI=1S/C11H24N2/c1-4-6-7-8-13-10-11(3)9-12-5-2/h10,12-13H,4-9H2,1-3H3/b11-10- |
| InChIKey | LJUWLRLBAQJGQU-KHPPLWFESA-N |
| XLogP | 2.28 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.33 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|