C12H22N2 — CID 175611149
(1E,5Z)-N-ethyl-5-methanimidoyl-2-methylocta-1,5-dien-1-amine (PubChem CID 175611149) has the molecular formula C12H22N2 and a molecular weight of 194.32 g/mol. Its IUPAC name is (1E,5Z)-N-ethyl-5-methanimidoyl-2-methylocta-1,5-dien-1-amine.
| Compound Name | (1E,5Z)-N-ethyl-5-methanimidoyl-2-methylocta-1,5-dien-1-amine |
|---|---|
| PubChem CID | 175611149 |
| Molecular Formula | C12H22N2 |
| Molecular Weight | 194.32 g/mol |
| Exact Mass | 194.18 |
| IUPAC Name | (1E,5Z)-N-ethyl-5-methanimidoyl-2-methylocta-1,5-dien-1-amine |
| SMILES | [H]/N=C/C(=C\CC)CC/C(C)=C/NCC |
| InChI | InChI=1S/C12H22N2/c1-4-6-12(9-13)8-7-11(3)10-14-5-2/h6,9-10,13-14H,4-5,7-8H2,1-3H3/b11-10+,12-6-,13-9+ |
| InChIKey | WTBBGAGGSOEXKQ-RJOKZMLXSA-N |
| XLogP | 3.27 |
| TPSA | 35.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.32 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|