C7H16N2 — CID 130458461
(E)-2-N-ethyl-1-N-methylbut-1-ene-1,2-diamine (PubChem CID 130458461) has the molecular formula C7H16N2 and a molecular weight of 128.22 g/mol. Its IUPAC name is (E)-2-N-ethyl-1-N-methylbut-1-ene-1,2-diamine.
| Compound Name | (E)-2-N-ethyl-1-N-methylbut-1-ene-1,2-diamine |
|---|---|
| PubChem CID | 130458461 |
| Molecular Formula | C7H16N2 |
| Molecular Weight | 128.22 g/mol |
| Exact Mass | 128.13 |
| IUPAC Name | (E)-2-N-ethyl-1-N-methylbut-1-ene-1,2-diamine |
| SMILES | CCN/C(=C/NC)CC |
| InChI | InChI=1S/C7H16N2/c1-4-7(6-8-3)9-5-2/h6,8-9H,4-5H2,1-3H3/b7-6+ |
| InChIKey | BUCCFVVPMOPFPB-VOTSOKGWSA-N |
| XLogP | 1.07 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 128.22 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |