About ethane;(Z)-2-N-ethyl-1-N-methylprop-1-ene-1,2-diamine
ethane;(Z)-2-N-ethyl-1-N-methylprop-1-ene-1,2-diamine (PubChem CID 142848070) has the molecular formula C8H20N2
and a molecular weight of 144.26 g/mol. Its IUPAC name is ethane;(Z)-2-N-ethyl-1-N-methylprop-1-ene-1,2-diamine.
Molecular Properties
| Compound Name | ethane;(Z)-2-N-ethyl-1-N-methylprop-1-ene-1,2-diamine |
| PubChem CID | 142848070 |
| Molecular Formula | C8H20N2 |
| Molecular Weight | 144.26 g/mol |
| Exact Mass | 144.16 |
| IUPAC Name | ethane;(Z)-2-N-ethyl-1-N-methylprop-1-ene-1,2-diamine |
| SMILES | CC.CCN/C(C)=C\NC |
| InChI | InChI=1S/C6H14N2.C2H6/c1-4-8-6(2)5-7-3;1-2/h5,7-8H,4H2,1-3H3;1-2H3/b6-5-; |
| InChIKey | NVFYCRGBPWEXSN-YSMBQZINSA-N |
| XLogP | 1.70 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 144.26 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethane;(Z)-2-N-ethyl-1-N-methylprop-1-ene-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;(Z)-2-N-ethyl-1-N-methylprop-1-ene-1,2-diamine?
The IUPAC name of ethane;(Z)-2-N-ethyl-1-N-methylprop-1-ene-1,2-diamine (CID 142848070) is ethane;(Z)-2-N-ethyl-1-N-methylprop-1-ene-1,2-diamine.
What is the SMILES notation for ethane;(Z)-2-N-ethyl-1-N-methylprop-1-ene-1,2-diamine?
The canonical SMILES for ethane;(Z)-2-N-ethyl-1-N-methylprop-1-ene-1,2-diamine is CC.CCN/C(C)=C\NC.
What is the InChIKey of ethane;(Z)-2-N-ethyl-1-N-methylprop-1-ene-1,2-diamine?
The InChIKey is NVFYCRGBPWEXSN-YSMBQZINSA-N. The full InChI is InChI=1S/C6H14N2.C2H6/c1-4-8-6(2)5-7-3;1-2/h5,7-8H,4H2,1-3H3;1-2H3/b6-5-;.
What are the key properties of ethane;(Z)-2-N-ethyl-1-N-methylprop-1-ene-1,2-diamine?
ethane;(Z)-2-N-ethyl-1-N-methylprop-1-ene-1,2-diamine has a molecular weight of 144.26 g/mol, XLogP of 1.70, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;(Z)-2-N-ethyl-1-N-methylprop-1-ene-1,2-diamine is sourced from PubChem (CID 142848070), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).