C5H11ClN2 — CID 130197807
(E)-2-N-(chloromethyl)-1-N-methylprop-1-ene-1,2-diamine (PubChem CID 130197807) has the molecular formula C5H11ClN2 and a molecular weight of 134.61 g/mol. Its IUPAC name is (E)-2-N-(chloromethyl)-1-N-methylprop-1-ene-1,2-diamine.
| Compound Name | (E)-2-N-(chloromethyl)-1-N-methylprop-1-ene-1,2-diamine |
|---|---|
| PubChem CID | 130197807 |
| Molecular Formula | C5H11ClN2 |
| Molecular Weight | 134.61 g/mol |
| Exact Mass | 134.06 |
| IUPAC Name | (E)-2-N-(chloromethyl)-1-N-methylprop-1-ene-1,2-diamine |
| SMILES | CN/C=C(\C)NCCl |
| InChI | InChI=1S/C5H11ClN2/c1-5(3-7-2)8-4-6/h3,7-8H,4H2,1-2H3/b5-3+ |
| InChIKey | HEKCZRQNANEYIF-HWKANZROSA-N |
| XLogP | 0.85 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 134.61 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|