C28H49O4- — CID 59271564
(E)-13-(6-hydroxy-2,7,8-trimethyl-3,4,4a,5,6,7,8,8a-octahydrochromen-2-yl)-2,6,10-trimethyltridec-5-enoate (PubChem CID 59271564) has the molecular formula C28H49O4- and a molecular weight of 449.70 g/mol. Its IUPAC name is (E)-13-(6-hydroxy-2,7,8-trimethyl-3,4,4a,5,6,7,8,8a-octahydrochromen-2-yl)-2,6,10-trimethyltridec-5-enoate.
| Compound Name | (E)-13-(6-hydroxy-2,7,8-trimethyl-3,4,4a,5,6,7,8,8a-octahydrochromen-2-yl)-2,6,10-trimethyltridec-5-enoate |
|---|---|
| PubChem CID | 59271564 |
| Molecular Formula | C28H49O4- |
| Molecular Weight | 449.70 g/mol |
| Exact Mass | 449.36 |
| IUPAC Name | (E)-13-(6-hydroxy-2,7,8-trimethyl-3,4,4a,5,6,7,8,8a-octahydrochromen-2-yl)-2,6,10-trimethyltridec-5-enoate |
| SMILES | C/C(=C\CCC(C)C(=O)[O-])CCCC(C)CCCC1(C)CCC2CC(O)C(C)C(C)C2O1 |
| InChI | InChI=1S/C28H50O4/c1-19(12-8-14-21(3)27(30)31)10-7-11-20(2)13-9-16-28(6)17-15-24-18-25(29)22(4)23(5)26(24)32-28/h12,20-26,29H,7-11,13-18H2,1-6H3,(H,30,31)/p-1/b19-12+ |
| InChIKey | QRXBGBNVJKSQAF-XDHOZWIPSA-M |
| XLogP | 5.67 |
| TPSA | 69.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.70 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|