C29H53O4- — CID 143728404
(3R)-7-hydroxy-14-(6-hydroxy-2,7,8-trimethyl-3,4,4a,5,6,7,8,8a-octahydrochromen-2-yl)-3,7,11-trimethyltetradec-1-en-2-olate (PubChem CID 143728404) has the molecular formula C29H53O4- and a molecular weight of 465.74 g/mol. Its IUPAC name is (3R)-7-hydroxy-14-(6-hydroxy-2,7,8-trimethyl-3,4,4a,5,6,7,8,8a-octahydrochromen-2-yl)-3,7,11-trimethyltetradec-1-en-2-olate.
| Compound Name | (3R)-7-hydroxy-14-(6-hydroxy-2,7,8-trimethyl-3,4,4a,5,6,7,8,8a-octahydrochromen-2-yl)-3,7,11-trimethyltetradec-1-en-2-olate |
|---|---|
| PubChem CID | 143728404 |
| Molecular Formula | C29H53O4- |
| Molecular Weight | 465.74 g/mol |
| Exact Mass | 465.39 |
| IUPAC Name | (3R)-7-hydroxy-14-(6-hydroxy-2,7,8-trimethyl-3,4,4a,5,6,7,8,8a-octahydrochromen-2-yl)-3,7,11-trimethyltetradec-1-en-2-olate |
| SMILES | C=C([O-])[C@H](C)CCCC(C)(O)CCCC(C)CCCC1(C)CCC2CC(O)C(C)C(C)C2O1 |
| InChI | InChI=1S/C29H54O4/c1-20(11-8-15-28(6,32)16-10-13-21(2)24(5)30)12-9-17-29(7)18-14-25-19-26(31)22(3)23(4)27(25)33-29/h20-23,25-27,30-32H,5,8-19H2,1-4,6-7H3/p-1/t20?,21-,22?,23?,25?,26?,27?,28?,29?/m1/s1 |
| InChIKey | YAWUBTINYKMQOC-AVBRBYOWSA-M |
| XLogP | 5.99 |
| TPSA | 72.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.74 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|