C28H54O5 — CID 143728361
13-(6-hydroxy-2,7,8-trimethyl-3,4,4a,5,6,7,8,8a-octahydrochromen-2-yl)-2,6,10-trimethyltridecane-1,1,6-triol (PubChem CID 143728361) has the molecular formula C28H54O5 and a molecular weight of 470.74 g/mol. Its IUPAC name is 13-(6-hydroxy-2,7,8-trimethyl-3,4,4a,5,6,7,8,8a-octahydrochromen-2-yl)-2,6,10-trimethyltridecane-1,1,6-triol.
| Compound Name | 13-(6-hydroxy-2,7,8-trimethyl-3,4,4a,5,6,7,8,8a-octahydrochromen-2-yl)-2,6,10-trimethyltridecane-1,1,6-triol |
|---|---|
| PubChem CID | 143728361 |
| Molecular Formula | C28H54O5 |
| Molecular Weight | 470.74 g/mol |
| Exact Mass | 470.40 |
| IUPAC Name | 13-(6-hydroxy-2,7,8-trimethyl-3,4,4a,5,6,7,8,8a-octahydrochromen-2-yl)-2,6,10-trimethyltridecane-1,1,6-triol |
| SMILES | CC(CCCC(C)(O)CCCC(C)C(O)O)CCCC1(C)CCC2CC(O)C(C)C(C)C2O1 |
| InChI | InChI=1S/C28H54O5/c1-19(10-7-14-27(5,32)15-9-12-20(2)26(30)31)11-8-16-28(6)17-13-23-18-24(29)21(3)22(4)25(23)33-28/h19-26,29-32H,7-18H2,1-6H3 |
| InChIKey | BSLVMTWOPUCDQO-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 90.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.74 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|