C29H50O4 — CID 143425609
(11E)-14-(6-hydroxy-2,7,8-trimethyl-3,4,5,6,7,8-hexahydrochromen-2-yl)-3,7,11-trimethyltetradeca-1,11-diene-2,7-diol (PubChem CID 143425609) has the molecular formula C29H50O4 and a molecular weight of 462.72 g/mol. Its IUPAC name is (11E)-14-(6-hydroxy-2,7,8-trimethyl-3,4,5,6,7,8-hexahydrochromen-2-yl)-3,7,11-trimethyltetradeca-1,11-diene-2,7-diol.
| Compound Name | (11E)-14-(6-hydroxy-2,7,8-trimethyl-3,4,5,6,7,8-hexahydrochromen-2-yl)-3,7,11-trimethyltetradeca-1,11-diene-2,7-diol |
|---|---|
| PubChem CID | 143425609 |
| Molecular Formula | C29H50O4 |
| Molecular Weight | 462.72 g/mol |
| Exact Mass | 462.37 |
| IUPAC Name | (11E)-14-(6-hydroxy-2,7,8-trimethyl-3,4,5,6,7,8-hexahydrochromen-2-yl)-3,7,11-trimethyltetradeca-1,11-diene-2,7-diol |
| SMILES | C=C(O)C(C)CCCC(C)(O)CCC/C(C)=C/CCC1(C)CCC2=C(O1)C(C)C(C)C(O)C2 |
| InChI | InChI=1S/C29H50O4/c1-20(11-8-15-28(6,32)16-10-13-21(2)24(5)30)12-9-17-29(7)18-14-25-19-26(31)22(3)23(4)27(25)33-29/h12,21-23,26,30-32H,5,8-11,13-19H2,1-4,6-7H3/b20-12+ |
| InChIKey | KVRLISYXOUQRDH-UDWIEESQSA-N |
| XLogP | 7.37 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.72 |
| LogP ≤ 5 | 7.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|