C25H39BrO2 — CID 159207141
(E)-2-bromo-2,6-dimethyl-9-[(2R)-2,5,6,7,8-pentamethyl-3,4-dihydrochromen-2-yl]non-6-en-3-ol (PubChem CID 159207141) has the molecular formula C25H39BrO2 and a molecular weight of 451.49 g/mol. Its IUPAC name is (E)-2-bromo-2,6-dimethyl-9-[(2R)-2,5,6,7,8-pentamethyl-3,4-dihydrochromen-2-yl]non-6-en-3-ol.
| Compound Name | (E)-2-bromo-2,6-dimethyl-9-[(2R)-2,5,6,7,8-pentamethyl-3,4-dihydrochromen-2-yl]non-6-en-3-ol |
|---|---|
| PubChem CID | 159207141 |
| Molecular Formula | C25H39BrO2 |
| Molecular Weight | 451.49 g/mol |
| Exact Mass | 450.21 |
| IUPAC Name | (E)-2-bromo-2,6-dimethyl-9-[(2R)-2,5,6,7,8-pentamethyl-3,4-dihydrochromen-2-yl]non-6-en-3-ol |
| SMILES | C/C(=C\CC[C@]1(C)CCc2c(C)c(C)c(C)c(C)c2O1)CCC(O)C(C)(C)Br |
| InChI | InChI=1S/C25H39BrO2/c1-16(11-12-22(27)24(6,7)26)10-9-14-25(8)15-13-21-19(4)17(2)18(3)20(5)23(21)28-25/h10,22,27H,9,11-15H2,1-8H3/b16-10+/t22?,25-/m1/s1 |
| InChIKey | YQNFDOAAVVTGTA-JOYLKFQUSA-N |
| XLogP | 7.05 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.49 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|