C35H59BrO3Si — CID 156720921
(6E,10E)-2-bromo-13-[(2R)-6-[tert-butyl(dimethyl)silyl]oxy-2,5,7,8-tetramethyl-3,4-dihydrochromen-2-yl]-2,6,10-trimethyltrideca-6,10-dien-3-ol (PubChem CID 156720921) has the molecular formula C35H59BrO3Si and a molecular weight of 635.84 g/mol. Its IUPAC name is (6E,10E)-2-bromo-13-[(2R)-6-[tert-butyl(dimethyl)silyl]oxy-2,5,7,8-tetramethyl-3,4-dihydrochromen-2-yl]-2,6,10-trimethyltrideca-6,10-dien-3-ol.
| Compound Name | (6E,10E)-2-bromo-13-[(2R)-6-[tert-butyl(dimethyl)silyl]oxy-2,5,7,8-tetramethyl-3,4-dihydrochromen-2-yl]-2,6,10-trimethyltrideca-6,10-dien-3-ol |
|---|---|
| PubChem CID | 156720921 |
| Molecular Formula | C35H59BrO3Si |
| Molecular Weight | 635.84 g/mol |
| Exact Mass | 634.34 |
| IUPAC Name | (6E,10E)-2-bromo-13-[(2R)-6-[tert-butyl(dimethyl)silyl]oxy-2,5,7,8-tetramethyl-3,4-dihydrochromen-2-yl]-2,6,10-trimethyltrideca-6,10-dien-3-ol |
| SMILES | C/C(=C\CC[C@]1(C)CCc2c(C)c(O[Si](C)(C)C(C)(C)C)c(C)c(C)c2O1)CC/C=C(\C)CCC(O)C(C)(C)Br |
| InChI | InChI=1S/C35H59BrO3Si/c1-24(16-14-17-25(2)19-20-30(37)34(9,10)36)18-15-22-35(11)23-21-29-28(5)31(26(3)27(4)32(29)38-35)39-40(12,13)33(6,7)8/h17-18,30,37H,14-16,19-23H2,1-13H3/b24-18+,25-17+/t30?,35-/m1/s1 |
| InChIKey | KMMCULYLVFZGAB-YNBUQJPUSA-N |
| XLogP | 10.85 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.84 |
| LogP ≤ 5 | 10.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|