C20H38O5 — CID 148920527
(2S,3S)-2,3,4-trihydroxy-8,12,16-trimethylheptadec-7-enoic acid (PubChem CID 148920527) has the molecular formula C20H38O5 and a molecular weight of 358.52 g/mol. Its IUPAC name is (2S,3S)-2,3,4-trihydroxy-8,12,16-trimethylheptadec-7-enoic acid.
| Compound Name | (2S,3S)-2,3,4-trihydroxy-8,12,16-trimethylheptadec-7-enoic acid |
|---|---|
| PubChem CID | 148920527 |
| Molecular Formula | C20H38O5 |
| Molecular Weight | 358.52 g/mol |
| Exact Mass | 358.27 |
| IUPAC Name | (2S,3S)-2,3,4-trihydroxy-8,12,16-trimethylheptadec-7-enoic acid |
| SMILES | CC(=CCCC(O)[C@H](O)[C@H](O)C(=O)O)CCCC(C)CCCC(C)C |
| InChI | InChI=1S/C20H38O5/c1-14(2)8-5-9-15(3)10-6-11-16(4)12-7-13-17(21)18(22)19(23)20(24)25/h12,14-15,17-19,21-23H,5-11,13H2,1-4H3,(H,24,25)/t15?,17?,18-,19-/m0/s1 |
| InChIKey | JHIGRAORGCCSAC-FYOYPEGLSA-N |
| XLogP | 3.51 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.52 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|