C16H27O- — CID 59229420
5-ethoxy-1,6-dimethyl-4-(3-methylpentyl)cyclohexa-1,3-diene (PubChem CID 59229420) has the molecular formula C16H27O- and a molecular weight of 235.39 g/mol. Its IUPAC name is 5-ethoxy-1,6-dimethyl-4-(3-methylpentyl)cyclohexa-1,3-diene.
| Compound Name | 5-ethoxy-1,6-dimethyl-4-(3-methylpentyl)cyclohexa-1,3-diene |
|---|---|
| PubChem CID | 59229420 |
| Molecular Formula | C16H27O- |
| Molecular Weight | 235.39 g/mol |
| Exact Mass | 235.21 |
| IUPAC Name | 5-ethoxy-1,6-dimethyl-4-(3-methylpentyl)cyclohexa-1,3-diene |
| SMILES | [CH2-]CC(C)CCC1=CC=C(C)C(C)C1OCC |
| InChI | InChI=1S/C16H27O/c1-6-12(3)8-10-15-11-9-13(4)14(5)16(15)17-7-2/h9,11-12,14,16H,1,6-8,10H2,2-5H3/q-1 |
| InChIKey | ZFWJDINQQRYFAI-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.39 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|