C20H30O — CID 163035558
(2R,4R,4aS,7aR,10aS,10bR)-4,10-dimethyl-7-methylidene-2-(2-methylprop-1-enyl)-2,3,4,4a,5,6,7a,8,10a,10b-decahydroazuleno[4,5-b]pyran (PubChem CID 163035558) has the molecular formula C20H30O and a molecular weight of 286.46 g/mol. Its IUPAC name is (2R,4R,4aS,7aR,10aS,10bR)-4,10-dimethyl-7-methylidene-2-(2-methylprop-1-enyl)-2,3,4,4a,5,6,7a,8,10a,10b-decahydroazuleno[4,5-b]pyran.
| Compound Name | (2R,4R,4aS,7aR,10aS,10bR)-4,10-dimethyl-7-methylidene-2-(2-methylprop-1-enyl)-2,3,4,4a,5,6,7a,8,10a,10b-decahydroazuleno[4,5-b]pyran |
|---|---|
| PubChem CID | 163035558 |
| Molecular Formula | C20H30O |
| Molecular Weight | 286.46 g/mol |
| Exact Mass | 286.23 |
| IUPAC Name | (2R,4R,4aS,7aR,10aS,10bR)-4,10-dimethyl-7-methylidene-2-(2-methylprop-1-enyl)-2,3,4,4a,5,6,7a,8,10a,10b-decahydroazuleno[4,5-b]pyran |
| SMILES | C=C1CC[C@@H]2[C@@H](O[C@@H](C=C(C)C)C[C@H]2C)[C@@H]2C(C)=CC[C@@H]12 |
| InChI | InChI=1S/C20H30O/c1-12(2)10-16-11-15(5)18-9-6-13(3)17-8-7-14(4)19(17)20(18)21-16/h7,10,15-20H,3,6,8-9,11H2,1-2,4-5H3/t15-,16+,17+,18+,19-,20-/m1/s1 |
| InChIKey | SJRLAXDCOGHISS-UHBLESBASA-N |
| XLogP | 5.29 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.46 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|