C21H33N — CID 162877836
N-[3,6,9-trimethyl-7-(2-methylprop-1-enyl)-1,2,3,4,6a,7,8,9,9a,9b-decahydrophenalen-3a-yl]methanimine (PubChem CID 162877836) has the molecular formula C21H33N and a molecular weight of 299.50 g/mol. Its IUPAC name is N-[3,6,9-trimethyl-7-(2-methylprop-1-enyl)-1,2,3,4,6a,7,8,9,9a,9b-decahydrophenalen-3a-yl]methanimine.
| Compound Name | N-[3,6,9-trimethyl-7-(2-methylprop-1-enyl)-1,2,3,4,6a,7,8,9,9a,9b-decahydrophenalen-3a-yl]methanimine |
|---|---|
| PubChem CID | 162877836 |
| Molecular Formula | C21H33N |
| Molecular Weight | 299.50 g/mol |
| Exact Mass | 299.26 |
| IUPAC Name | N-[3,6,9-trimethyl-7-(2-methylprop-1-enyl)-1,2,3,4,6a,7,8,9,9a,9b-decahydrophenalen-3a-yl]methanimine |
| SMILES | C=NC12CC=C(C)C3C(C=C(C)C)CC(C)C(CCC1C)C32 |
| InChI | InChI=1S/C21H33N/c1-13(2)11-17-12-15(4)18-8-7-16(5)21(22-6)10-9-14(3)19(17)20(18)21/h9,11,15-20H,6-8,10,12H2,1-5H3 |
| InChIKey | BBWZURJIVMADBA-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.50 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|