C21H34N- — CID 163152926
[1,4-dimethyl-7-methylidene-6-(2-methylprop-1-enyl)-3,3a,4,5,6,6a,8,9,9a,9b-decahydro-2H-phenalen-1-yl]-methylazanide (PubChem CID 163152926) has the molecular formula C21H34N- and a molecular weight of 300.51 g/mol. Its IUPAC name is [1,4-dimethyl-7-methylidene-6-(2-methylprop-1-enyl)-3,3a,4,5,6,6a,8,9,9a,9b-decahydro-2H-phenalen-1-yl]-methylazanide.
| Compound Name | [1,4-dimethyl-7-methylidene-6-(2-methylprop-1-enyl)-3,3a,4,5,6,6a,8,9,9a,9b-decahydro-2H-phenalen-1-yl]-methylazanide |
|---|---|
| PubChem CID | 163152926 |
| Molecular Formula | C21H34N- |
| Molecular Weight | 300.51 g/mol |
| Exact Mass | 300.27 |
| IUPAC Name | [1,4-dimethyl-7-methylidene-6-(2-methylprop-1-enyl)-3,3a,4,5,6,6a,8,9,9a,9b-decahydro-2H-phenalen-1-yl]-methylazanide |
| SMILES | C=C1CCC2C3C(CCC2(C)[N-]C)C(C)CC(C=C(C)C)C13 |
| InChI | InChI=1S/C21H34N/c1-13(2)11-16-12-15(4)17-9-10-21(5,22-6)18-8-7-14(3)19(16)20(17)18/h11,15-20H,3,7-10,12H2,1-2,4-6H3/q-1 |
| InChIKey | OJKYVTAWDHDFNW-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 14.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.51 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|