C19H30O2 — CID 71507798
(3aS,4R,6aR,7S,9R,9aS,9bR)-4-hydroxy-4,7-dimethyl-9-(2-methylprop-1-enyl)-3,3a,5,6,6a,7,8,9,9a,9b-decahydro-2H-phenalen-1-one (PubChem CID 71507798) has the molecular formula C19H30O2 and a molecular weight of 290.45 g/mol. Its IUPAC name is (3aS,4R,6aR,7S,9R,9aS,9bR)-4-hydroxy-4,7-dimethyl-9-(2-methylprop-1-enyl)-3,3a,5,6,6a,7,8,9,9a,9b-decahydro-2H-phenalen-1-one.
| Compound Name | (3aS,4R,6aR,7S,9R,9aS,9bR)-4-hydroxy-4,7-dimethyl-9-(2-methylprop-1-enyl)-3,3a,5,6,6a,7,8,9,9a,9b-decahydro-2H-phenalen-1-one |
|---|---|
| PubChem CID | 71507798 |
| Molecular Formula | C19H30O2 |
| Molecular Weight | 290.45 g/mol |
| Exact Mass | 290.22 |
| IUPAC Name | (3aS,4R,6aR,7S,9R,9aS,9bR)-4-hydroxy-4,7-dimethyl-9-(2-methylprop-1-enyl)-3,3a,5,6,6a,7,8,9,9a,9b-decahydro-2H-phenalen-1-one |
| SMILES | CC(C)=C[C@H]1C[C@H](C)[C@H]2CC[C@@](C)(O)[C@H]3CCC(=O)[C@@H]1[C@H]23 |
| InChI | InChI=1S/C19H30O2/c1-11(2)9-13-10-12(3)14-7-8-19(4,21)15-5-6-16(20)17(13)18(14)15/h9,12-15,17-18,21H,5-8,10H2,1-4H3/t12-,13-,14+,15-,17+,18+,19+/m0/s1 |
| InChIKey | SVRFMMHXRHTASG-BYLAAXHHSA-N |
| XLogP | 3.98 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.45 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|