C21H34N- — CID 163127285
[(2S,3aR,5S,5aS,8R,8aS,8bR)-2,5,8-trimethyl-8a-[(1E)-3-methylbuta-1,3-dienyl]-1,2,3,3a,4,5a,6,7,8,8b-decahydroacenaphthylen-5-yl]-methylazanide (PubChem CID 163127285) has the molecular formula C21H34N- and a molecular weight of 300.51 g/mol. Its IUPAC name is [(2S,3aR,5S,5aS,8R,8aS,8bR)-2,5,8-trimethyl-8a-[(1E)-3-methylbuta-1,3-dienyl]-1,2,3,3a,4,5a,6,7,8,8b-decahydroacenaphthylen-5-yl]-methylazanide.
| Compound Name | [(2S,3aR,5S,5aS,8R,8aS,8bR)-2,5,8-trimethyl-8a-[(1E)-3-methylbuta-1,3-dienyl]-1,2,3,3a,4,5a,6,7,8,8b-decahydroacenaphthylen-5-yl]-methylazanide |
|---|---|
| PubChem CID | 163127285 |
| Molecular Formula | C21H34N- |
| Molecular Weight | 300.51 g/mol |
| Exact Mass | 300.27 |
| IUPAC Name | [(2S,3aR,5S,5aS,8R,8aS,8bR)-2,5,8-trimethyl-8a-[(1E)-3-methylbuta-1,3-dienyl]-1,2,3,3a,4,5a,6,7,8,8b-decahydroacenaphthylen-5-yl]-methylazanide |
| SMILES | C=C(C)/C=C/[C@]12C[C@H](C)[C@H]3CC[C@](C)([N-]C)[C@@H](CC[C@H]1C)[C@@H]32 |
| InChI | InChI=1S/C21H34N/c1-14(2)9-12-21-13-15(3)17-10-11-20(5,22-6)18(19(17)21)8-7-16(21)4/h9,12,15-19H,1,7-8,10-11,13H2,2-6H3/q-1/b12-9+/t15-,16+,17+,18-,19+,20-,21-/m0/s1 |
| InChIKey | COJFZBSDXJQROW-YCWOHVLPSA-N |
| XLogP | 5.98 |
| TPSA | 14.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.51 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|