C16H24O3 — CID 5363751
[3,4,4-trimethyl-3-[(1Z)-3-methylbuta-1,3-dienyl]-2-oxocyclohexyl] acetate (PubChem CID 5363751) has the molecular formula C16H24O3 and a molecular weight of 264.37 g/mol. Its IUPAC name is [3,4,4-trimethyl-3-[(1Z)-3-methylbuta-1,3-dienyl]-2-oxocyclohexyl] acetate.
| Compound Name | [3,4,4-trimethyl-3-[(1Z)-3-methylbuta-1,3-dienyl]-2-oxocyclohexyl] acetate |
|---|---|
| PubChem CID | 5363751 |
| Molecular Formula | C16H24O3 |
| Molecular Weight | 264.37 g/mol |
| Exact Mass | 264.17 |
| IUPAC Name | [3,4,4-trimethyl-3-[(1Z)-3-methylbuta-1,3-dienyl]-2-oxocyclohexyl] acetate |
| SMILES | C=C(C)/C=C\C1(C)C(=O)C(OC(C)=O)CCC1(C)C |
| InChI | InChI=1S/C16H24O3/c1-11(2)7-10-16(6)14(18)13(19-12(3)17)8-9-15(16,4)5/h7,10,13H,1,8-9H2,2-6H3/b10-7- |
| InChIKey | HMVFTVAHPXFAGK-YFHOEESVSA-N |
| XLogP | 3.45 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.37 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|