C10H16 — CID 163690199
1,4-dimethyltricyclo[3.2.1.03,8]octane (PubChem CID 163690199) has the molecular formula C10H16 and a molecular weight of 136.24 g/mol. Its IUPAC name is 1,4-dimethyltricyclo[3.2.1.03,8]octane.
| Compound Name | 1,4-dimethyltricyclo[3.2.1.03,8]octane |
|---|---|
| PubChem CID | 163690199 |
| Molecular Formula | C10H16 |
| Molecular Weight | 136.24 g/mol |
| Exact Mass | 136.13 |
| IUPAC Name | 1,4-dimethyltricyclo[3.2.1.03,8]octane |
| SMILES | CC1C2CCC3(C)CC1C23 |
| InChI | InChI=1S/C10H16/c1-6-7-3-4-10(2)5-8(6)9(7)10/h6-9H,3-5H2,1-2H3 |
| InChIKey | JSILDXBCZKTWHC-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 136.24 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |