C24H42O — CID 155752417
1-(4,6a,8,12a-tetramethyl-1,2,3,4,4a,4b,5,6,7,8,9,10,10a,10b,11,12-hexadecahydrochrysen-1-yl)ethanol (PubChem CID 155752417) has the molecular formula C24H42O and a molecular weight of 346.60 g/mol. Its IUPAC name is 1-(4,6a,8,12a-tetramethyl-1,2,3,4,4a,4b,5,6,7,8,9,10,10a,10b,11,12-hexadecahydrochrysen-1-yl)ethanol.
| Compound Name | 1-(4,6a,8,12a-tetramethyl-1,2,3,4,4a,4b,5,6,7,8,9,10,10a,10b,11,12-hexadecahydrochrysen-1-yl)ethanol |
|---|---|
| PubChem CID | 155752417 |
| Molecular Formula | C24H42O |
| Molecular Weight | 346.60 g/mol |
| Exact Mass | 346.32 |
| IUPAC Name | 1-(4,6a,8,12a-tetramethyl-1,2,3,4,4a,4b,5,6,7,8,9,10,10a,10b,11,12-hexadecahydrochrysen-1-yl)ethanol |
| SMILES | CC1CCC2C3CCC4(C)C(C(C)O)CCC(C)C4C3CCC2(C)C1 |
| InChI | InChI=1S/C24H42O/c1-15-6-8-21-18-11-13-24(5)20(17(3)25)9-7-16(2)22(24)19(18)10-12-23(21,4)14-15/h15-22,25H,6-14H2,1-5H3 |
| InChIKey | MWZXYCZTHMGCRR-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.60 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |