C22H36O — CID 155733164
1-[(5R)-5,13-dimethyl-3-methylidene-1,2,4,6,7,8,9,10,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]ethanol (PubChem CID 155733164) has the molecular formula C22H36O and a molecular weight of 316.53 g/mol. Its IUPAC name is 1-[(5R)-5,13-dimethyl-3-methylidene-1,2,4,6,7,8,9,10,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]ethanol.
| Compound Name | 1-[(5R)-5,13-dimethyl-3-methylidene-1,2,4,6,7,8,9,10,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]ethanol |
|---|---|
| PubChem CID | 155733164 |
| Molecular Formula | C22H36O |
| Molecular Weight | 316.53 g/mol |
| Exact Mass | 316.28 |
| IUPAC Name | 1-[(5R)-5,13-dimethyl-3-methylidene-1,2,4,6,7,8,9,10,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]ethanol |
| SMILES | C=C1CCC2C3CCC4(C)C(C(C)O)CCC4C3CC[C@]2(C)C1 |
| InChI | InChI=1S/C22H36O/c1-14-5-6-19-16-10-12-22(4)18(15(2)23)7-8-20(22)17(16)9-11-21(19,3)13-14/h15-20,23H,1,5-13H2,2-4H3/t15?,16?,17?,18?,19?,20?,21-,22?/m1/s1 |
| InChIKey | QTRDQKHWSOOEDD-PUOAEEPKSA-N |
| XLogP | 5.58 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.53 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|