C23H38O — CID 11890571
(1S)-1-[(5S,8R,9R,10R,13S,14S,17S)-5,10,13-trimethyl-2-methylidene-3,4,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]ethanol (PubChem CID 11890571) has the molecular formula C23H38O and a molecular weight of 330.56 g/mol. Its IUPAC name is (1S)-1-[(5S,8R,9R,10R,13S,14S,17S)-5,10,13-trimethyl-2-methylidene-3,4,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]ethanol.
| Compound Name | (1S)-1-[(5S,8R,9R,10R,13S,14S,17S)-5,10,13-trimethyl-2-methylidene-3,4,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]ethanol |
|---|---|
| PubChem CID | 11890571 |
| Molecular Formula | C23H38O |
| Molecular Weight | 330.56 g/mol |
| Exact Mass | 330.29 |
| IUPAC Name | (1S)-1-[(5S,8R,9R,10R,13S,14S,17S)-5,10,13-trimethyl-2-methylidene-3,4,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]ethanol |
| SMILES | C=C1CC[C@]2(C)CC[C@H]3[C@@H](CC[C@]4(C)[C@@H]([C@H](C)O)CC[C@@H]34)[C@@]2(C)C1 |
| InChI | InChI=1S/C23H38O/c1-15-8-11-21(3)12-9-17-19-7-6-18(16(2)24)22(19,4)13-10-20(17)23(21,5)14-15/h16-20,24H,1,6-14H2,2-5H3/t16-,17+,18+,19-,20+,21+,22+,23+/m0/s1 |
| InChIKey | DKVSCGXPVFHNKP-AMNZAEFNSA-N |
| XLogP | 5.97 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.56 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|