C20H32O — CID 73084164
1,4,12,12-tetramethyl-8-methylidene-11-oxatetracyclo[8.5.1.03,7.013,16]hexadecane (PubChem CID 73084164) has the molecular formula C20H32O and a molecular weight of 288.48 g/mol. Its IUPAC name is 1,4,12,12-tetramethyl-8-methylidene-11-oxatetracyclo[8.5.1.03,7.013,16]hexadecane.
| Compound Name | 1,4,12,12-tetramethyl-8-methylidene-11-oxatetracyclo[8.5.1.03,7.013,16]hexadecane |
|---|---|
| PubChem CID | 73084164 |
| Molecular Formula | C20H32O |
| Molecular Weight | 288.48 g/mol |
| Exact Mass | 288.25 |
| IUPAC Name | 1,4,12,12-tetramethyl-8-methylidene-11-oxatetracyclo[8.5.1.03,7.013,16]hexadecane |
| SMILES | C=C1CC2OC(C)(C)C3CCC(C)(CC4C(C)CCC14)C23 |
| InChI | InChI=1S/C20H32O/c1-12-6-7-14-13(2)10-17-18-16(19(3,4)21-17)8-9-20(18,5)11-15(12)14/h12,14-18H,2,6-11H2,1,3-5H3 |
| InChIKey | PODKCDPRHXSRRA-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.48 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|